About 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole
2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole (PubChem CID 90310343) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole.
Molecular Properties
| Compound Name | 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole |
| PubChem CID | 90310343 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole |
| SMILES | Cc1nc2oc(C(C)C)c(C(C)C)c2o1 |
| InChI | InChI=1S/C12H17NO2/c1-6(2)9-10(7(3)4)15-12-11(9)14-8(5)13-12/h6-7H,1-5H3 |
| InChIKey | XIRQNBNZDOOWPB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole?
The IUPAC name of 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole (CID 90310343) is 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole.
What is the SMILES notation for 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole?
The canonical SMILES for 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole is Cc1nc2oc(C(C)C)c(C(C)C)c2o1.
What is the InChIKey of 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole?
The InChIKey is XIRQNBNZDOOWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-6(2)9-10(7(3)4)15-12-11(9)14-8(5)13-12/h6-7H,1-5H3.
What are the key properties of 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole?
2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole has a molecular weight of 207.27 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-di(propan-2-yl)furo[2,3-d][1,3]oxazole is sourced from PubChem (CID 90310343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).