C20H36O4 — CID 90311182
bis(2-methylpropyl) 2-(2,2,4,4-tetramethylpentan-3-ylidene)propanedioate (PubChem CID 90311182) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-(2,2,4,4-tetramethylpentan-3-ylidene)propanedioate.
| Compound Name | bis(2-methylpropyl) 2-(2,2,4,4-tetramethylpentan-3-ylidene)propanedioate |
|---|---|
| PubChem CID | 90311182 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | bis(2-methylpropyl) 2-(2,2,4,4-tetramethylpentan-3-ylidene)propanedioate |
| SMILES | CC(C)COC(=O)C(C(=O)OCC(C)C)=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H36O4/c1-13(2)11-23-17(21)15(18(22)24-12-14(3)4)16(19(5,6)7)20(8,9)10/h13-14H,11-12H2,1-10H3 |
| InChIKey | RUSJUKJSQAETBT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|