About 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone
1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone (PubChem CID 90311204) has the molecular formula C14H18N2O5
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone |
| PubChem CID | 90311204 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(C)c(C)c1CCCC([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O5/c1-9-7-8-13(11(3)17)12(10(9)2)5-4-6-14(15(18)19)16(20)21/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | QRRXGGPFFVZPTH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone?
The IUPAC name of 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone (CID 90311204) is 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone.
What is the SMILES notation for 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone?
The canonical SMILES for 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone is CC(=O)c1ccc(C)c(C)c1CCCC([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone?
The InChIKey is QRRXGGPFFVZPTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O5/c1-9-7-8-13(11(3)17)12(10(9)2)5-4-6-14(15(18)19)16(20)21/h7-8,14H,4-6H2,1-3H3.
What are the key properties of 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone?
1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone has a molecular weight of 294.31 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,4-dinitrobutyl)-3,4-dimethylphenyl]ethanone is sourced from PubChem (CID 90311204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).