C24H24N4O3 — CID 90311416
tert-butyl 2-[3-[4-(2-pyridin-4-ylethynyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate (PubChem CID 90311416) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is tert-butyl 2-[3-[4-(2-pyridin-4-ylethynyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[4-(2-pyridin-4-ylethynyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90311416 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | tert-butyl 2-[3-[4-(2-pyridin-4-ylethynyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc(-c2ccc(C#Cc3ccncc3)cc2)no1 |
| InChI | InChI=1S/C24H24N4O3/c1-24(2,3)30-23(29)28-16-4-5-20(28)22-26-21(27-31-22)19-10-8-17(9-11-19)6-7-18-12-14-25-15-13-18/h8-15,20H,4-5,16H2,1-3H3 |
| InChIKey | JQQQORUIBOJUJA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|