C25H10F6O6 — CID 90311523
5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]-2-benzofuran-1,3-dione (PubChem CID 90311523) has the molecular formula C25H10F6O6 and a molecular weight of 520.34 g/mol. Its IUPAC name is 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 90311523 |
| Molecular Formula | C25H10F6O6 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(c3cccc(C(F)(F)F)c3)(c3ccc4c(c3)C(=O)OC4=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H10F6O6/c26-24(27,28)14-3-1-2-11(8-14)23(25(29,30)31,12-4-6-15-17(9-12)21(34)36-19(15)32)13-5-7-16-18(10-13)22(35)37-20(16)33/h1-10H |
| InChIKey | KSKLOBSPAXSOEG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|