C18H39NO4Si2 — CID 90311649
(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidine-1-carboxylic acid (PubChem CID 90311649) has the molecular formula C18H39NO4Si2 and a molecular weight of 389.69 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidine-1-carboxylic acid.
| Compound Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90311649 |
| Molecular Formula | C18H39NO4Si2 |
| Molecular Weight | 389.69 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCN(C(=O)O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H39NO4Si2/c1-17(2,3)24(7,8)22-14-11-12-19(16(20)21)13-15(14)23-25(9,10)18(4,5)6/h14-15H,11-13H2,1-10H3,(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | RZKHRHDEGKVUSX-HUUCEWRRSA-N |
| XLogP | 5.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|