About 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine
5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine (PubChem CID 90313443) has the molecular formula C20H19FN4O4S2
and a molecular weight of 462.53 g/mol. Its IUPAC name is 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine |
| PubChem CID | 90313443 |
| Molecular Formula | C20H19FN4O4S2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccc(-c3cccnc3S(=O)(=O)C3CCS(=O)(=O)CC3)cc2F)cn1 |
| InChI | InChI=1S/C20H19FN4O4S2/c21-18-10-13(3-4-16(18)14-11-24-20(22)25-12-14)17-2-1-7-23-19(17)31(28,29)15-5-8-30(26,27)9-6-15/h1-4,7,10-12,15H,5-6,8-9H2,(H2,22,24,25) |
| InChIKey | MEOQPOYAINRQAE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine?
The IUPAC name of 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine (CID 90313443) is 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine.
What is the SMILES notation for 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine?
The canonical SMILES for 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine is Nc1ncc(-c2ccc(-c3cccnc3S(=O)(=O)C3CCS(=O)(=O)CC3)cc2F)cn1.
What is the InChIKey of 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine?
The InChIKey is MEOQPOYAINRQAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19FN4O4S2/c21-18-10-13(3-4-16(18)14-11-24-20(22)25-12-14)17-2-1-7-23-19(17)31(28,29)15-5-8-30(26,27)9-6-15/h1-4,7,10-12,15H,5-6,8-9H2,(H2,22,24,25).
What are the key properties of 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine?
5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine has a molecular weight of 462.53 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[2-(1,1-dioxothian-4-yl)sulfonyl-3-pyridinyl]-2-fluorophenyl]pyrimidin-2-amine is sourced from PubChem (CID 90313443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).