About N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide
N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide (PubChem CID 90313552) has the molecular formula C20H22FN5O2S
and a molecular weight of 415.49 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide |
| PubChem CID | 90313552 |
| Molecular Formula | C20H22FN5O2S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)c(N)n2)c(F)c1 |
| InChI | InChI=1S/C20H22FN5O2S/c1-20(2,3)26-29(27,28)17-7-5-4-6-13(17)12-8-9-14(15(21)10-12)16-11-24-18(22)19(23)25-16/h4-11,26H,1-3H3,(H2,22,24)(H2,23,25) |
| InChIKey | RKCLORDBWUVMKX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide?
The IUPAC name of N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide (CID 90313552) is N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide.
What is the SMILES notation for N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide?
The canonical SMILES for N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide is CC(C)(C)NS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)c(N)n2)c(F)c1.
What is the InChIKey of N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide?
The InChIKey is RKCLORDBWUVMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN5O2S/c1-20(2,3)26-29(27,28)17-7-5-4-6-13(17)12-8-9-14(15(21)10-12)16-11-24-18(22)19(23)25-16/h4-11,26H,1-3H3,(H2,22,24)(H2,23,25).
What are the key properties of N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide?
N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide has a molecular weight of 415.49 g/mol, XLogP of 3.19, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[4-(5,6-diaminopyrazin-2-yl)-3-fluorophenyl]benzenesulfonamide is sourced from PubChem (CID 90313552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).