About 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine
5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine (PubChem CID 90314102) has the molecular formula C18H13F4N3O
and a molecular weight of 363.31 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine |
| PubChem CID | 90314102 |
| Molecular Formula | C18H13F4N3O |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3OCC(F)(F)F)cc2F)cn1 |
| InChI | InChI=1S/C18H13F4N3O/c19-14-7-11(5-6-13(14)15-8-25-17(23)9-24-15)12-3-1-2-4-16(12)26-10-18(20,21)22/h1-9H,10H2,(H2,23,25) |
| InChIKey | AIINITHHVDCCCY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine?
The IUPAC name of 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine (CID 90314102) is 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine.
What is the SMILES notation for 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine?
The canonical SMILES for 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine is Nc1cnc(-c2ccc(-c3ccccc3OCC(F)(F)F)cc2F)cn1.
What is the InChIKey of 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine?
The InChIKey is AIINITHHVDCCCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F4N3O/c19-14-7-11(5-6-13(14)15-8-25-17(23)9-24-15)12-3-1-2-4-16(12)26-10-18(20,21)22/h1-9H,10H2,(H2,23,25).
What are the key properties of 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine?
5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine has a molecular weight of 363.31 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)phenyl]phenyl]pyrazin-2-amine is sourced from PubChem (CID 90314102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).