C21H16FN5O2S — CID 90314206
5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfonylmethyl)phenyl]phenyl]pyrazin-2-amine (PubChem CID 90314206) has the molecular formula C21H16FN5O2S and a molecular weight of 421.46 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfonylmethyl)phenyl]phenyl]pyrazin-2-amine.
| Compound Name | 5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfonylmethyl)phenyl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 90314206 |
| Molecular Formula | C21H16FN5O2S |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 5-[2-fluoro-4-[2-(pyrimidin-2-ylsulfonylmethyl)phenyl]phenyl]pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc(-c3ccccc3CS(=O)(=O)c3ncccn3)cc2F)cn1 |
| InChI | InChI=1S/C21H16FN5O2S/c22-18-10-14(6-7-17(18)19-11-27-20(23)12-26-19)16-5-2-1-4-15(16)13-30(28,29)21-24-8-3-9-25-21/h1-12H,13H2,(H2,23,27) |
| InChIKey | SWSRNDJVTYSFLT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |