About 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine
5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine (PubChem CID 90314323) has the molecular formula C17H13F2N3O2S
and a molecular weight of 361.37 g/mol. Its IUPAC name is 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine |
| PubChem CID | 90314323 |
| Molecular Formula | C17H13F2N3O2S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine |
| SMILES | CS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1F |
| InChI | InChI=1S/C17H13F2N3O2S/c1-25(23,24)14-5-3-2-4-10(14)11-6-7-12(17(19)16(11)18)13-8-22-15(20)9-21-13/h2-9H,1H3,(H2,20,22) |
| InChIKey | IUANZCPBZWQDOK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine?
The IUPAC name of 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine (CID 90314323) is 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine.
What is the SMILES notation for 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine?
The canonical SMILES for 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine is CS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)cn2)c(F)c1F.
What is the InChIKey of 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine?
The InChIKey is IUANZCPBZWQDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O2S/c1-25(23,24)14-5-3-2-4-10(14)11-6-7-12(17(19)16(11)18)13-8-22-15(20)9-21-13/h2-9H,1H3,(H2,20,22).
What are the key properties of 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine?
5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine has a molecular weight of 361.37 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,3-difluoro-4-(2-methylsulfonylphenyl)phenyl]pyrazin-2-amine is sourced from PubChem (CID 90314323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).