About N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide
N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 90314560) has the molecular formula C15H16Cl2N2O3S
and a molecular weight of 375.28 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
| PubChem CID | 90314560 |
| Molecular Formula | C15H16Cl2N2O3S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CN1CC(C(=O)NCCCSc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C15H16Cl2N2O3S/c1-19-8-10(13(20)15(19)22)14(21)18-5-2-6-23-9-3-4-11(16)12(17)7-9/h3-4,7,20H,2,5-6,8H2,1H3,(H,18,21) |
| InChIKey | HCLSSYWCNGSMFF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide?
The IUPAC name of N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide (CID 90314560) is N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide.
What is the SMILES notation for N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide?
The canonical SMILES for N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide is CN1CC(C(=O)NCCCSc2ccc(Cl)c(Cl)c2)=C(O)C1=O.
What is the InChIKey of N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide?
The InChIKey is HCLSSYWCNGSMFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2O3S/c1-19-8-10(13(20)15(19)22)14(21)18-5-2-6-23-9-3-4-11(16)12(17)7-9/h3-4,7,20H,2,5-6,8H2,1H3,(H,18,21).
What are the key properties of N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide?
N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide has a molecular weight of 375.28 g/mol, XLogP of 2.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-dichlorophenyl)sulfanylpropyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide is sourced from PubChem (CID 90314560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).