C19H22N4O5 — CID 90314567
ethyl 1-[3-[(4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carbonyl)amino]propyl]indazole-5-carboxylate (PubChem CID 90314567) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is ethyl 1-[3-[(4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carbonyl)amino]propyl]indazole-5-carboxylate.
| Compound Name | ethyl 1-[3-[(4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carbonyl)amino]propyl]indazole-5-carboxylate |
|---|---|
| PubChem CID | 90314567 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | ethyl 1-[3-[(4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carbonyl)amino]propyl]indazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(cnn2CCCNC(=O)C2=C(O)C(=O)N(C)C2)c1 |
| InChI | InChI=1S/C19H22N4O5/c1-3-28-19(27)12-5-6-15-13(9-12)10-21-23(15)8-4-7-20-17(25)14-11-22(2)18(26)16(14)24/h5-6,9-10,24H,3-4,7-8,11H2,1-2H3,(H,20,25) |
| InChIKey | BPSYNRLOLXXHFK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|