C17H11ClF4N4 — CID 90314766
N-[(4-chloro-2-fluorophenyl)methyl]-6-[5-(trifluoromethyl)-3-pyridinyl]pyrimidin-4-amine (PubChem CID 90314766) has the molecular formula C17H11ClF4N4 and a molecular weight of 382.75 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-6-[5-(trifluoromethyl)-3-pyridinyl]pyrimidin-4-amine.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-6-[5-(trifluoromethyl)-3-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90314766 |
| Molecular Formula | C17H11ClF4N4 |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-6-[5-(trifluoromethyl)-3-pyridinyl]pyrimidin-4-amine |
| SMILES | Fc1cc(Cl)ccc1CNc1cc(-c2cncc(C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C17H11ClF4N4/c18-13-2-1-10(14(19)4-13)7-24-16-5-15(25-9-26-16)11-3-12(8-23-6-11)17(20,21)22/h1-6,8-9H,7H2,(H,24,25,26) |
| InChIKey | FXMJGKUMJRIFFT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |