C18H21Cl2N3O6S — CID 90315018
N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[3-(methanesulfonamido)-3-oxopropyl]-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 90315018) has the molecular formula C18H21Cl2N3O6S and a molecular weight of 478.35 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[3-(methanesulfonamido)-3-oxopropyl]-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[3-(methanesulfonamido)-3-oxopropyl]-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90315018 |
| Molecular Formula | C18H21Cl2N3O6S |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)propyl]-4-hydroxy-1-[3-(methanesulfonamido)-3-oxopropyl]-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)CCN1CC(C(=O)NCCCc2ccc(Cl)c(Cl)c2)=C(O)C1=O |
| InChI | InChI=1S/C18H21Cl2N3O6S/c1-30(28,29)22-15(24)6-8-23-10-12(16(25)18(23)27)17(26)21-7-2-3-11-4-5-13(19)14(20)9-11/h4-5,9,25H,2-3,6-8,10H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | MINNVSZMKGTHNY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|