C21H19N5O — CID 90315596
5-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole (PubChem CID 90315596) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 5-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole.
| Compound Name | 5-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 90315596 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 5-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)-3-[5-(2-pyridin-2-ylethynyl)-2-pyridinyl]-1,2,4-oxadiazole |
| SMILES | C(#Cc1ccccn1)c1ccc(-c2noc(C34CCCN3CCC4)n2)nc1 |
| InChI | InChI=1S/C21H19N5O/c1-2-12-22-17(5-1)8-6-16-7-9-18(23-15-16)19-24-20(27-25-19)21-10-3-13-26(21)14-4-11-21/h1-2,5,7,9,12,15H,3-4,10-11,13-14H2 |
| InChIKey | KMAKMGZXBNZVBN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|