About (1-sulfanylcyclopropyl) acetate
(1-sulfanylcyclopropyl) acetate (PubChem CID 90315897) has the molecular formula C5H8O2S
and a molecular weight of 132.18 g/mol. Its IUPAC name is (1-sulfanylcyclopropyl) acetate.
Molecular Properties
| Compound Name | (1-sulfanylcyclopropyl) acetate |
| PubChem CID | 90315897 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | (1-sulfanylcyclopropyl) acetate |
| SMILES | CC(=O)OC1(S)CC1 |
| InChI | InChI=1S/C5H8O2S/c1-4(6)7-5(8)2-3-5/h8H,2-3H2,1H3 |
| InChIKey | CYQRZVYMKGXZIB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1-sulfanylcyclopropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-sulfanylcyclopropyl) acetate?
The IUPAC name of (1-sulfanylcyclopropyl) acetate (CID 90315897) is (1-sulfanylcyclopropyl) acetate.
What is the SMILES notation for (1-sulfanylcyclopropyl) acetate?
The canonical SMILES for (1-sulfanylcyclopropyl) acetate is CC(=O)OC1(S)CC1.
What is the InChIKey of (1-sulfanylcyclopropyl) acetate?
The InChIKey is CYQRZVYMKGXZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S/c1-4(6)7-5(8)2-3-5/h8H,2-3H2,1H3.
What are the key properties of (1-sulfanylcyclopropyl) acetate?
(1-sulfanylcyclopropyl) acetate has a molecular weight of 132.18 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-sulfanylcyclopropyl) acetate is sourced from PubChem (CID 90315897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).