About 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride
2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride (PubChem CID 90316067) has the molecular formula C15H8BrClN2O
and a molecular weight of 347.60 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride |
| PubChem CID | 90316067 |
| Molecular Formula | C15H8BrClN2O |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2ccc(Br)cc2)nc2ccncc12 |
| InChI | InChI=1S/C15H8BrClN2O/c16-10-3-1-9(2-4-10)14-7-11(15(17)20)12-8-18-6-5-13(12)19-14/h1-8H |
| InChIKey | YVDGIHHLIIZYPH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride?
The IUPAC name of 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride (CID 90316067) is 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride.
What is the SMILES notation for 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride?
The canonical SMILES for 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride is O=C(Cl)c1cc(-c2ccc(Br)cc2)nc2ccncc12.
What is the InChIKey of 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride?
The InChIKey is YVDGIHHLIIZYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8BrClN2O/c16-10-3-1-9(2-4-10)14-7-11(15(17)20)12-8-18-6-5-13(12)19-14/h1-8H.
What are the key properties of 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride?
2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride has a molecular weight of 347.60 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,6-naphthyridine-4-carbonyl chloride is sourced from PubChem (CID 90316067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).