C30H34N6O2 — CID 90316337
4-[[(cyanoamino)-[4-(hydroxy-phenyl-pyridin-3-ylmethyl)piperidin-1-yl]methylidene]amino]-N,N-diethylbenzamide (PubChem CID 90316337) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-[[(cyanoamino)-[4-(hydroxy-phenyl-pyridin-3-ylmethyl)piperidin-1-yl]methylidene]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[(cyanoamino)-[4-(hydroxy-phenyl-pyridin-3-ylmethyl)piperidin-1-yl]methylidene]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 90316337 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 4-[[(cyanoamino)-[4-(hydroxy-phenyl-pyridin-3-ylmethyl)piperidin-1-yl]methylidene]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(/N=C(\NC#N)N2CCC(C(O)(c3ccccc3)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C30H34N6O2/c1-3-35(4-2)28(37)23-12-14-27(15-13-23)34-29(33-22-31)36-19-16-25(17-20-36)30(38,24-9-6-5-7-10-24)26-11-8-18-32-21-26/h5-15,18,21,25,38H,3-4,16-17,19-20H2,1-2H3,(H,33,34) |
| InChIKey | DXYYBAOVLPVZSU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|