C20H24F3N5O — CID 90316435
(1S)-4-[(Z)-amino-(3-amino-1H-pyridin-2-ylidene)methyl]-N-[C-ethenyl-N-(4,4,4-trifluorobutyl)carbonimidoyl]cyclohexa-2,4-diene-1-carboxamide (PubChem CID 90316435) has the molecular formula C20H24F3N5O and a molecular weight of 407.44 g/mol. Its IUPAC name is (1S)-4-[(Z)-amino-(3-amino-1H-pyridin-2-ylidene)methyl]-N-[C-ethenyl-N-(4,4,4-trifluorobutyl)carbonimidoyl]cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | (1S)-4-[(Z)-amino-(3-amino-1H-pyridin-2-ylidene)methyl]-N-[C-ethenyl-N-(4,4,4-trifluorobutyl)carbonimidoyl]cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 90316435 |
| Molecular Formula | C20H24F3N5O |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (1S)-4-[(Z)-amino-(3-amino-1H-pyridin-2-ylidene)methyl]-N-[C-ethenyl-N-(4,4,4-trifluorobutyl)carbonimidoyl]cyclohexa-2,4-diene-1-carboxamide |
| SMILES | C=C/C(=N\CCCC(F)(F)F)NC(=O)[C@@H]1C=CC(/C(N)=C2/NC=CC=C2N)=CC1 |
| InChI | InChI=1S/C20H24F3N5O/c1-2-16(26-12-4-10-20(21,22)23)28-19(29)14-8-6-13(7-9-14)17(25)18-15(24)5-3-11-27-18/h2-3,5-8,11,14,27H,1,4,9-10,12,24-25H2,(H,26,28,29)/b18-17-/t14-/m1/s1 |
| InChIKey | XSGOUMNIOYIMGV-MGPWXQLLSA-N |
| XLogP | 2.66 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|