About 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide
4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide (PubChem CID 90316595) has the molecular formula C27H28N2O3
and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide |
| PubChem CID | 90316595 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC(=C(c3ccccc3)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-31-23-13-14-24(25(19-23)32-2)28-27(30)29-17-15-22(16-18-29)26(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-14,19H,15-18H2,1-2H3,(H,28,30) |
| InChIKey | ICVHOQNHKLWLME-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide?
The IUPAC name of 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide (CID 90316595) is 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide.
What is the SMILES notation for 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide?
The canonical SMILES for 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide is COc1ccc(NC(=O)N2CCC(=C(c3ccccc3)c3ccccc3)CC2)c(OC)c1.
What is the InChIKey of 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide?
The InChIKey is ICVHOQNHKLWLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O3/c1-31-23-13-14-24(25(19-23)32-2)28-27(30)29-17-15-22(16-18-29)26(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-14,19H,15-18H2,1-2H3,(H,28,30).
What are the key properties of 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide?
4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide has a molecular weight of 428.53 g/mol, XLogP of 5.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydrylidene-N-(2,4-dimethoxyphenyl)piperidine-1-carboxamide is sourced from PubChem (CID 90316595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).