About 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide
3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide (PubChem CID 90316692) has the molecular formula C30H33N3O2
and a molecular weight of 467.61 g/mol. Its IUPAC name is 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide.
Molecular Properties
| Compound Name | 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide |
| PubChem CID | 90316692 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C30H33N3O2/c1-3-32(4-2)29(34)23-15-16-28(24(21-23)22-31)33-19-17-27(18-20-33)30(35,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-16,21,27,35H,3-4,17-20H2,1-2H3 |
| InChIKey | MHFVBIPZTNIBMJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide?
The IUPAC name of 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide (CID 90316692) is 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide.
What is the SMILES notation for 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide?
The canonical SMILES for 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide is CCN(CC)C(=O)c1ccc(N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c(C#N)c1.
What is the InChIKey of 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide?
The InChIKey is MHFVBIPZTNIBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H33N3O2/c1-3-32(4-2)29(34)23-15-16-28(24(21-23)22-31)33-19-17-27(18-20-33)30(35,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-16,21,27,35H,3-4,17-20H2,1-2H3.
What are the key properties of 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide?
3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide has a molecular weight of 467.61 g/mol, XLogP of 5.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N,N-diethyl-4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]benzamide is sourced from PubChem (CID 90316692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).