C26H34N4OS — CID 90317086
5-(4-cyclohepta-1,3,6-trien-1-yl-2-methoxyphenyl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90317086) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is 5-(4-cyclohepta-1,3,6-trien-1-yl-2-methoxyphenyl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-cyclohepta-1,3,6-trien-1-yl-2-methoxyphenyl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90317086 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 5-(4-cyclohepta-1,3,6-trien-1-yl-2-methoxyphenyl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cc(C2=CC=CCC=C2)ccc1-c1nnc(N(C)C2CC(C)(C)NC(C)(C)C2)s1 |
| InChI | InChI=1S/C26H34N4OS/c1-25(2)16-20(17-26(3,4)29-25)30(5)24-28-27-23(32-24)21-14-13-19(15-22(21)31-6)18-11-9-7-8-10-12-18/h7,9-15,20,29H,8,16-17H2,1-6H3 |
| InChIKey | OPRCIYJQNHTFLD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |