C20H28FN7S — CID 90317093
5-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-fluoro-2-pyridinyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90317093) has the molecular formula C20H28FN7S and a molecular weight of 417.56 g/mol. Its IUPAC name is 5-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-fluoro-2-pyridinyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-fluoro-2-pyridinyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90317093 |
| Molecular Formula | C20H28FN7S |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 5-[5-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-fluoro-2-pyridinyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | [H]/N=C/C(=C\N)c1cnc(-c2nnc(N(C)C3CC(C)(C)NC(C)(C)C3)s2)c(F)c1 |
| InChI | InChI=1S/C20H28FN7S/c1-19(2)7-14(8-20(3,4)27-19)28(5)18-26-25-17(29-18)16-15(21)6-12(11-24-16)13(9-22)10-23/h6,9-11,14,22,27H,7-8,23H2,1-5H3/b13-10+,22-9+ |
| InChIKey | VJOWZTDXIJYZPZ-MJMOSIHLSA-N |
| XLogP | 3.43 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|