C35H32F7NO4 — CID 90317182
4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-fluorophenyl]-3-methylbenzoic acid (PubChem CID 90317182) has the molecular formula C35H32F7NO4 and a molecular weight of 663.63 g/mol. Its IUPAC name is 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-fluorophenyl]-3-methylbenzoic acid.
| Compound Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-fluorophenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 90317182 |
| Molecular Formula | C35H32F7NO4 |
| Molecular Weight | 663.63 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-fluorophenyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1cc(F)cc(C2=C(CN3C(=O)O[C@H](c4cc(C(F)(F)F)cc(C(F)(F)F)c4)[C@@H]3C)CC(C)(C)CC2)c1 |
| InChI | InChI=1S/C35H32F7NO4/c1-18-9-20(31(44)45)5-6-28(18)21-10-22(14-27(36)13-21)29-7-8-33(3,4)16-24(29)17-43-19(2)30(47-32(43)46)23-11-25(34(37,38)39)15-26(12-23)35(40,41)42/h5-6,9-15,19,30H,7-8,16-17H2,1-4H3,(H,44,45)/t19-,30-/m0/s1 |
| InChIKey | ZWXPHAICTKQYSA-ADSBAMQRSA-N |
| XLogP | 10.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.63 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |