C36H32F9NO5 — CID 90317309
4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-(trifluoromethyl)benzoic acid (PubChem CID 90317309) has the molecular formula C36H32F9NO5 and a molecular weight of 729.64 g/mol. Its IUPAC name is 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 90317309 |
| Molecular Formula | C36H32F9NO5 |
| Molecular Weight | 729.64 g/mol |
| Exact Mass | 729.21 |
| IUPAC Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3-(trifluoromethyl)benzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)cc2C(F)(F)F)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C36H32F9NO5/c1-18-30(21-11-23(34(37,38)39)15-24(12-21)35(40,41)42)51-32(49)46(18)17-22-16-33(2,3)10-9-25(22)27-13-19(6-8-29(27)50-4)26-7-5-20(31(47)48)14-28(26)36(43,44)45/h5-8,11-15,18,30H,9-10,16-17H2,1-4H3,(H,47,48)/t18-,30-/m0/s1 |
| InChIKey | PPIZEIWFQOOBCX-PBYQXAPXSA-N |
| XLogP | 10.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.64 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |