C35H34F6N2O5 — CID 90317350
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-methylbenzoic acid (PubChem CID 90317350) has the molecular formula C35H34F6N2O5 and a molecular weight of 676.65 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 90317350 |
| Molecular Formula | C35H34F6N2O5 |
| Molecular Weight | 676.65 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-methylbenzoic acid |
| SMILES | COc1ncc(-c2ccc(C(=O)O)cc2C)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C35H34F6N2O5/c1-18-10-20(31(44)45)6-7-26(18)22-13-28(30(47-5)42-16-22)27-8-9-33(3,4)15-23(27)17-43-19(2)29(48-32(43)46)21-11-24(34(36,37)38)14-25(12-21)35(39,40)41/h6-7,10-14,16,19,29H,8-9,15,17H2,1-5H3,(H,44,45)/t19-,29-/m0/s1 |
| InChIKey | JGVQLLHIEXRNNI-SLQAJWMNSA-N |
| XLogP | 9.35 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.65 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |