About 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol
2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol (PubChem CID 90317590) has the molecular formula C13H13F3N4O
and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol.
Molecular Properties
| Compound Name | 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol |
| PubChem CID | 90317590 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol |
| SMILES | OC(Cn1cncn1)C1(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H13F3N4O/c14-13(15,16)9-1-2-10(18-5-9)12(3-4-12)11(21)6-20-8-17-7-19-20/h1-2,5,7-8,11,21H,3-4,6H2 |
| InChIKey | XQQMNOKBDMBLOV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol?
The IUPAC name of 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol (CID 90317590) is 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol is OC(Cn1cncn1)C1(c2ccc(C(F)(F)F)cn2)CC1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol?
The InChIKey is XQQMNOKBDMBLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N4O/c14-13(15,16)9-1-2-10(18-5-9)12(3-4-12)11(21)6-20-8-17-7-19-20/h1-2,5,7-8,11,21H,3-4,6H2.
What are the key properties of 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol?
2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol has a molecular weight of 298.27 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)-1-[1-[5-(trifluoromethyl)-2-pyridinyl]cyclopropyl]ethanol is sourced from PubChem (CID 90317590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).