About 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride
1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride (PubChem CID 90317694) has the molecular formula C6H13ClF3N3O
and a molecular weight of 235.64 g/mol. Its IUPAC name is 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride.
Molecular Properties
| Compound Name | 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride |
| PubChem CID | 90317694 |
| Molecular Formula | C6H13ClF3N3O |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride |
| SMILES | CC(C)NNC(=O)NCC(F)(F)F.Cl |
| InChI | InChI=1S/C6H12F3N3O.ClH/c1-4(2)11-12-5(13)10-3-6(7,8)9;/h4,11H,3H2,1-2H3,(H2,10,12,13);1H |
| InChIKey | FLLAMCGNGICQMC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride?
The IUPAC name of 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride (CID 90317694) is 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride.
What is the SMILES notation for 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride?
The canonical SMILES for 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride is CC(C)NNC(=O)NCC(F)(F)F.Cl.
What is the InChIKey of 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride?
The InChIKey is FLLAMCGNGICQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F3N3O.ClH/c1-4(2)11-12-5(13)10-3-6(7,8)9;/h4,11H,3H2,1-2H3,(H2,10,12,13);1H.
What are the key properties of 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride?
1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride has a molecular weight of 235.64 g/mol, XLogP of 1.18, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(propan-2-ylamino)-3-(2,2,2-trifluoroethyl)urea;hydrochloride is sourced from PubChem (CID 90317694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).