C29H29F3N6O4 — CID 90317958
6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid (PubChem CID 90317958) has the molecular formula C29H29F3N6O4 and a molecular weight of 582.58 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 90317958 |
| Molecular Formula | C29H29F3N6O4 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
| SMILES | C[C@@H](Nc1nc(C(=O)O)nc2nc(C(=O)N[C@@H](CO)c3ccccc3)n(Cc3ccc(C(F)(F)F)cc3)c12)C1CCC1 |
| InChI | InChI=1S/C29H29F3N6O4/c1-16(18-8-5-9-18)33-23-22-24(36-25(35-23)28(41)42)37-26(27(40)34-21(15-39)19-6-3-2-4-7-19)38(22)14-17-10-12-20(13-11-17)29(30,31)32/h2-4,6-7,10-13,16,18,21,39H,5,8-9,14-15H2,1H3,(H,34,40)(H,41,42)(H,33,35,36)/t16-,21+/m1/s1 |
| InChIKey | QBJOSXCXEQZZSB-IERDGZPVSA-N |
| XLogP | 4.66 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |