C20H30ClN5 — CID 90318024
2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[1-(4-methylcyclohexyl)ethyl]purin-6-amine (PubChem CID 90318024) has the molecular formula C20H30ClN5 and a molecular weight of 375.95 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[1-(4-methylcyclohexyl)ethyl]purin-6-amine.
| Compound Name | 2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[1-(4-methylcyclohexyl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 90318024 |
| Molecular Formula | C20H30ClN5 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[1-(4-methylcyclohexyl)ethyl]purin-6-amine |
| SMILES | CC1CCC(C(C)n2cnc3nc(Cl)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C20H30ClN5/c1-12-7-9-16(10-8-12)14(3)26-11-22-18-17(26)19(25-20(21)24-18)23-13(2)15-5-4-6-15/h11-16H,4-10H2,1-3H3,(H,23,24,25)/t12?,13-,14?,16?/m1/s1 |
| InChIKey | DFPGEPCZFJBWAF-YRUXVQORSA-N |
| XLogP | 5.47 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |