C33H34F6N6O2 — CID 90318394
6-[[(1R)-1-cyclobutylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]-8-[2-[[3-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]purine-2-carboxylic acid (PubChem CID 90318394) has the molecular formula C33H34F6N6O2 and a molecular weight of 660.66 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]-8-[2-[[3-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]purine-2-carboxylic acid.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]-8-[2-[[3-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 90318394 |
| Molecular Formula | C33H34F6N6O2 |
| Molecular Weight | 660.66 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]-8-[2-[[3-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]purine-2-carboxylic acid |
| SMILES | C[C@@H](Nc1nc(C(=O)O)nc2nc(N3CCCCC3Cc3cccc(C(F)(F)F)c3)n(Cc3ccc(C(F)(F)F)cc3)c12)C1CCC1 |
| InChI | InChI=1S/C33H34F6N6O2/c1-19(22-7-5-8-22)40-27-26-28(42-29(41-27)30(46)47)43-31(45(26)18-20-11-13-23(14-12-20)32(34,35)36)44-15-3-2-10-25(44)17-21-6-4-9-24(16-21)33(37,38)39/h4,6,9,11-14,16,19,22,25H,2-3,5,7-8,10,15,17-18H2,1H3,(H,46,47)(H,40,41,42)/t19-,25?/m1/s1 |
| InChIKey | NUTZLOBJSZPDNO-OEPVSBQMSA-N |
| XLogP | 7.81 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |