C30H32F3N7O2 — CID 90318455
6-[[(1R)-1-cyclobutylethyl]amino]-8-(2-pyridin-3-ylpiperidin-1-yl)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid (PubChem CID 90318455) has the molecular formula C30H32F3N7O2 and a molecular weight of 579.63 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-8-(2-pyridin-3-ylpiperidin-1-yl)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-(2-pyridin-3-ylpiperidin-1-yl)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 90318455 |
| Molecular Formula | C30H32F3N7O2 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-(2-pyridin-3-ylpiperidin-1-yl)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
| SMILES | C[C@@H](Nc1nc(C(=O)O)nc2nc(N3CCCCC3c3cccnc3)n(Cc3ccc(C(F)(F)F)cc3)c12)C1CCC1 |
| InChI | InChI=1S/C30H32F3N7O2/c1-18(20-6-4-7-20)35-25-24-26(37-27(36-25)28(41)42)38-29(39-15-3-2-9-23(39)21-8-5-14-34-16-21)40(24)17-19-10-12-22(13-11-19)30(31,32)33/h5,8,10-14,16,18,20,23H,2-4,6-7,9,15,17H2,1H3,(H,41,42)(H,35,36,37)/t18-,23?/m1/s1 |
| InChIKey | GZCSZKVEPLMADG-FKSKYRLFSA-N |
| XLogP | 6.32 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |