C22H25NO4 — CID 90319157
2-[2-(4-hexoxyphenoxy)ethyl]isoindole-1,3-dione (PubChem CID 90319157) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2-[2-(4-hexoxyphenoxy)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-hexoxyphenoxy)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90319157 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[2-(4-hexoxyphenoxy)ethyl]isoindole-1,3-dione |
| SMILES | CCCCCCOc1ccc(OCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-2-3-4-7-15-26-17-10-12-18(13-11-17)27-16-14-23-21(24)19-8-5-6-9-20(19)22(23)25/h5-6,8-13H,2-4,7,14-16H2,1H3 |
| InChIKey | ZYTMLSPDRNXGTD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|