About 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole
2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 90319196) has the molecular formula C6H7BrN2
and a molecular weight of 187.04 g/mol. Its IUPAC name is 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| PubChem CID | 90319196 |
| Molecular Formula | C6H7BrN2 |
| Molecular Weight | 187.04 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | Brc1cc2n(n1)CCC2 |
| InChI | InChI=1S/C6H7BrN2/c7-6-4-5-2-1-3-9(5)8-6/h4H,1-3H2 |
| InChIKey | RYEGWNUMFCRGFU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.04 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The IUPAC name of 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (CID 90319196) is 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
What is the SMILES notation for 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The canonical SMILES for 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is Brc1cc2n(n1)CCC2.
What is the InChIKey of 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The InChIKey is RYEGWNUMFCRGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2/c7-6-4-5-2-1-3-9(5)8-6/h4H,1-3H2.
What are the key properties of 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole has a molecular weight of 187.04 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is sourced from PubChem (CID 90319196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).