C13H17N3O2S — CID 90319590
6,6-dioxo-6λ6-thia-3-azatricyclo[9.4.0.02,7]pentadeca-8,10,12,14-tetraene-4,14-diamine (PubChem CID 90319590) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 6,6-dioxo-6λ6-thia-3-azatricyclo[9.4.0.02,7]pentadeca-8,10,12,14-tetraene-4,14-diamine.
| Compound Name | 6,6-dioxo-6λ6-thia-3-azatricyclo[9.4.0.02,7]pentadeca-8,10,12,14-tetraene-4,14-diamine |
|---|---|
| PubChem CID | 90319590 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6,6-dioxo-6λ6-thia-3-azatricyclo[9.4.0.02,7]pentadeca-8,10,12,14-tetraene-4,14-diamine |
| SMILES | NC1=CC2C(=CC=CC3C2NC(N)CS3(=O)=O)C=C1 |
| InChI | InChI=1S/C13H17N3O2S/c14-9-5-4-8-2-1-3-11-13(10(8)6-9)16-12(15)7-19(11,17)18/h1-6,10-13,16H,7,14-15H2 |
| InChIKey | LWNACFYHZSSNHN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |