C21H32O6 — CID 90320394
12-ethyl-3,5,6,11,15,16-hexamethyl-2,8,10,13,18-pentaoxapentacyclo[15.1.0.01,3.07,9.09,11]octadecan-14-one (PubChem CID 90320394) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 12-ethyl-3,5,6,11,15,16-hexamethyl-2,8,10,13,18-pentaoxapentacyclo[15.1.0.01,3.07,9.09,11]octadecan-14-one.
| Compound Name | 12-ethyl-3,5,6,11,15,16-hexamethyl-2,8,10,13,18-pentaoxapentacyclo[15.1.0.01,3.07,9.09,11]octadecan-14-one |
|---|---|
| PubChem CID | 90320394 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 12-ethyl-3,5,6,11,15,16-hexamethyl-2,8,10,13,18-pentaoxapentacyclo[15.1.0.01,3.07,9.09,11]octadecan-14-one |
| SMILES | CCC1OC(=O)C(C)C(C)C2OC23OC3(C)CC(C)C(C)C2OC23OC13C |
| InChI | InChI=1S/C21H32O6/c1-8-14-19(7)21(27-19)15(25-21)11(3)10(2)9-18(6)20(26-18)16(24-20)12(4)13(5)17(22)23-14/h10-16H,8-9H2,1-7H3 |
| InChIKey | XKZLHNKXNUWQNZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|