C27H35FO6 — CID 90320397
(3R,4S,5R,7R,9R,10S,15R)-15-ethyl-5-fluoro-7,10-dihydroxy-3,7,9,14-tetramethyl-4-phenylmethoxy-1-oxacyclopentadeca-11,12,13-triene-2,6-dione (PubChem CID 90320397) has the molecular formula C27H35FO6 and a molecular weight of 474.57 g/mol. Its IUPAC name is (3R,4S,5R,7R,9R,10S,15R)-15-ethyl-5-fluoro-7,10-dihydroxy-3,7,9,14-tetramethyl-4-phenylmethoxy-1-oxacyclopentadeca-11,12,13-triene-2,6-dione.
| Compound Name | (3R,4S,5R,7R,9R,10S,15R)-15-ethyl-5-fluoro-7,10-dihydroxy-3,7,9,14-tetramethyl-4-phenylmethoxy-1-oxacyclopentadeca-11,12,13-triene-2,6-dione |
|---|---|
| PubChem CID | 90320397 |
| Molecular Formula | C27H35FO6 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (3R,4S,5R,7R,9R,10S,15R)-15-ethyl-5-fluoro-7,10-dihydroxy-3,7,9,14-tetramethyl-4-phenylmethoxy-1-oxacyclopentadeca-11,12,13-triene-2,6-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H](OCc2ccccc2)[C@@H](F)C(=O)[C@](C)(O)C[C@@H](C)[C@H](O)C=C=C=C1C |
| InChI | InChI=1S/C27H35FO6/c1-6-22-17(2)11-10-14-21(29)18(3)15-27(5,32)25(30)23(28)24(19(4)26(31)34-22)33-16-20-12-8-7-9-13-20/h7-9,12-14,18-19,21-24,29,32H,6,15-16H2,1-5H3/b17-14-/t18-,19-,21-,22-,23-,24+,27-/m1/s1 |
| InChIKey | HRLHGDCQCHGVKQ-OSFXYNESSA-N |
| XLogP | 3.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |