C33H66O8Si2 — CID 90320423
(3R,4S,5R,6R,7R,9R,10S,11S,13R,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-6,7,13-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,12-dione (PubChem CID 90320423) has the molecular formula C33H66O8Si2 and a molecular weight of 647.06 g/mol. Its IUPAC name is (3R,4S,5R,6R,7R,9R,10S,11S,13R,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-6,7,13-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,12-dione.
| Compound Name | (3R,4S,5R,6R,7R,9R,10S,11S,13R,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-6,7,13-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,12-dione |
|---|---|
| PubChem CID | 90320423 |
| Molecular Formula | C33H66O8Si2 |
| Molecular Weight | 647.06 g/mol |
| Exact Mass | 646.43 |
| IUPAC Name | (3R,4S,5R,6R,7R,9R,10S,11S,13R,14R)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-6,7,13-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,12-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)[C@](C)(O)C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@]1(C)O |
| InChI | InChI=1S/C33H66O8Si2/c1-18-24-33(13,38)28(35)21(3)25(40-42(14,15)30(6,7)8)20(2)19-32(12,37)27(34)22(4)26(23(5)29(36)39-24)41-43(16,17)31(9,10)11/h20-27,34,37-38H,18-19H2,1-17H3/t20-,21+,22+,23-,24-,25+,26+,27-,32-,33-/m1/s1 |
| InChIKey | CGEQYZJFDZPAFL-PYVMGEMPSA-N |
| XLogP | 6.47 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.06 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|