C21H34O5 — CID 90320424
5-ethyl-4,4,8,9,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione (PubChem CID 90320424) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 5-ethyl-4,4,8,9,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione.
| Compound Name | 5-ethyl-4,4,8,9,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione |
|---|---|
| PubChem CID | 90320424 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 5-ethyl-4,4,8,9,12,14-hexamethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione |
| SMILES | CCC1OC(=O)C(C)C(C)CC(=O)C2(C)CC(C)C(CC(=O)C1(C)C)O2 |
| InChI | InChI=1S/C21H34O5/c1-8-18-20(5,6)16(22)10-15-13(3)11-21(7,26-15)17(23)9-12(2)14(4)19(24)25-18/h12-15,18H,8-11H2,1-7H3 |
| InChIKey | DEFAPQHRKPDOEE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |