C29H52O7Si — CID 90320691
(3R,4S,7R,9R,10E,13R,14R)-4-butoxy-14-ethyl-13-hydroxy-3,7,9,13-tetramethyl-7-triethylsilyloxy-1-oxacyclotetradec-10-ene-2,6,12-trione (PubChem CID 90320691) has the molecular formula C29H52O7Si and a molecular weight of 540.81 g/mol. Its IUPAC name is (3R,4S,7R,9R,10E,13R,14R)-4-butoxy-14-ethyl-13-hydroxy-3,7,9,13-tetramethyl-7-triethylsilyloxy-1-oxacyclotetradec-10-ene-2,6,12-trione.
| Compound Name | (3R,4S,7R,9R,10E,13R,14R)-4-butoxy-14-ethyl-13-hydroxy-3,7,9,13-tetramethyl-7-triethylsilyloxy-1-oxacyclotetradec-10-ene-2,6,12-trione |
|---|---|
| PubChem CID | 90320691 |
| Molecular Formula | C29H52O7Si |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | (3R,4S,7R,9R,10E,13R,14R)-4-butoxy-14-ethyl-13-hydroxy-3,7,9,13-tetramethyl-7-triethylsilyloxy-1-oxacyclotetradec-10-ene-2,6,12-trione |
| SMILES | CCCCO[C@H]1CC(=O)[C@](C)(O[Si](CC)(CC)CC)C[C@@H](C)/C=C/C(=O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C29H52O7Si/c1-10-15-18-34-23-19-25(31)28(8,36-37(12-3,13-4)14-5)20-21(6)16-17-24(30)29(9,33)26(11-2)35-27(32)22(23)7/h16-17,21-23,26,33H,10-15,18-20H2,1-9H3/b17-16+/t21-,22+,23-,26+,28+,29-/m0/s1 |
| InChIKey | NEWQEYBTJZCUHQ-ANNUGUSISA-N |
| XLogP | 5.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|