C31H54O6Si — CID 90320722
(3R,4R,5R)-4-butoxy-5-[(4R,5S,6R,9R)-5-butoxy-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-4-methylundeca-1,7-diynyl]-3-methyloxolan-2-one (PubChem CID 90320722) has the molecular formula C31H54O6Si and a molecular weight of 550.85 g/mol. Its IUPAC name is (3R,4R,5R)-4-butoxy-5-[(4R,5S,6R,9R)-5-butoxy-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-4-methylundeca-1,7-diynyl]-3-methyloxolan-2-one.
| Compound Name | (3R,4R,5R)-4-butoxy-5-[(4R,5S,6R,9R)-5-butoxy-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-4-methylundeca-1,7-diynyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 90320722 |
| Molecular Formula | C31H54O6Si |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | (3R,4R,5R)-4-butoxy-5-[(4R,5S,6R,9R)-5-butoxy-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-4-methylundeca-1,7-diynyl]-3-methyloxolan-2-one |
| SMILES | CCCCO[C@H]([C@H](O)C#C[C@@H](CC)O[Si](C)(C)C(C)(C)C)[C@H](C)CC#C[C@H]1OC(=O)[C@H](C)[C@H]1OCCCC |
| InChI | InChI=1S/C31H54O6Si/c1-11-14-21-34-28(26(32)20-19-25(13-3)37-38(9,10)31(6,7)8)23(4)17-16-18-27-29(35-22-15-12-2)24(5)30(33)36-27/h23-29,32H,11-15,17,21-22H2,1-10H3/t23-,24-,25-,26-,27-,28+,29-/m1/s1 |
| InChIKey | QCJIITFHWMWNIZ-JSLGRRRXSA-N |
| XLogP | 6.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|