C15H23F9O3 — CID 90321046
2,2-difluoro-3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(1,1,2-trifluoro-2-methylbutoxy)butoxy]butan-1-ol (PubChem CID 90321046) has the molecular formula C15H23F9O3 and a molecular weight of 422.33 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(1,1,2-trifluoro-2-methylbutoxy)butoxy]butan-1-ol.
| Compound Name | 2,2-difluoro-3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(1,1,2-trifluoro-2-methylbutoxy)butoxy]butan-1-ol |
|---|---|
| PubChem CID | 90321046 |
| Molecular Formula | C15H23F9O3 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2,2-difluoro-3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(1,1,2-trifluoro-2-methylbutoxy)butoxy]butan-1-ol |
| SMILES | CCC(C)(F)C(F)(F)OC(C)(C)C(F)(F)C(F)(F)OC(C)(C)C(F)(F)CO |
| InChI | InChI=1S/C15H23F9O3/c1-7-11(6,16)14(21,22)27-10(4,5)13(19,20)15(23,24)26-9(2,3)12(17,18)8-25/h25H,7-8H2,1-6H3 |
| InChIKey | PGUQFSXWPMAFLY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|