C12H16ClN3O6 — CID 90321048
1-(1-chloro-2-methoxyethyl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 90321048) has the molecular formula C12H16ClN3O6 and a molecular weight of 333.73 g/mol. Its IUPAC name is 1-(1-chloro-2-methoxyethyl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1-chloro-2-methoxyethyl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90321048 |
| Molecular Formula | C12H16ClN3O6 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-(1-chloro-2-methoxyethyl)-3,5-bis(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | COCC(Cl)n1c(=O)n(CC2CO2)c(=O)n(CC2CO2)c1=O |
| InChI | InChI=1S/C12H16ClN3O6/c1-20-6-9(13)16-11(18)14(2-7-4-21-7)10(17)15(12(16)19)3-8-5-22-8/h7-9H,2-6H2,1H3 |
| InChIKey | AWFQESWDBMBOKE-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 100.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|