C30H36N4O6S2 — CID 90321329
(1S,7S,10S,16E)-7-(naphthalen-1-ylmethyl)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 90321329) has the molecular formula C30H36N4O6S2 and a molecular weight of 612.77 g/mol. Its IUPAC name is (1S,7S,10S,16E)-7-(naphthalen-1-ylmethyl)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (1S,7S,10S,16E)-7-(naphthalen-1-ylmethyl)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 90321329 |
| Molecular Formula | C30H36N4O6S2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | (1S,7S,10S,16E)-7-(naphthalen-1-ylmethyl)-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | CC(C)C1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)N[C@@H](Cc1cccc3ccccc13)C(=O)NCC(=O)O2 |
| InChI | InChI=1S/C30H36N4O6S2/c1-18(2)27-30(39)33-24-17-42-41-13-6-5-11-21(15-25(35)34-27)40-26(36)16-31-28(37)23(32-29(24)38)14-20-10-7-9-19-8-3-4-12-22(19)20/h3-5,7-12,18,21,23-24,27H,6,13-17H2,1-2H3,(H,31,37)(H,32,38)(H,33,39)(H,34,35)/b11-5+/t21-,23+,24-,27?/m1/s1 |
| InChIKey | IQKOKBCGYSCUAD-WYCHOMTHSA-N |
| XLogP | 2.27 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|