About 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine
4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine (PubChem CID 90321693) has the molecular formula C21H37N3
and a molecular weight of 331.55 g/mol. Its IUPAC name is 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine.
Molecular Properties
| Compound Name | 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine |
| PubChem CID | 90321693 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine |
| SMILES | C1=CC(C2CC(C3CCCCN3)NC(C3CCCCN3)C2)CCC1 |
| InChI | InChI=1S/C21H37N3/c1-2-8-16(9-3-1)17-14-20(18-10-4-6-12-22-18)24-21(15-17)19-11-5-7-13-23-19/h2,8,16-24H,1,3-7,9-15H2 |
| InChIKey | JKEULJIXEUDIQX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine?
The IUPAC name of 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine (CID 90321693) is 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine.
What is the SMILES notation for 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine?
The canonical SMILES for 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine is C1=CC(C2CC(C3CCCCN3)NC(C3CCCCN3)C2)CCC1.
What is the InChIKey of 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine?
The InChIKey is JKEULJIXEUDIQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N3/c1-2-8-16(9-3-1)17-14-20(18-10-4-6-12-22-18)24-21(15-17)19-11-5-7-13-23-19/h2,8,16-24H,1,3-7,9-15H2.
What are the key properties of 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine?
4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine has a molecular weight of 331.55 g/mol, XLogP of 3.36, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohex-2-en-1-yl-2,6-di(piperidin-2-yl)piperidine is sourced from PubChem (CID 90321693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).