C14H16N2 — CID 90321779
(3R,6S)-3-ethynyl-6-[(2R,5S)-5-ethynyl-2,3,4,5-tetrahydropyridin-2-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 90321779) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (3R,6S)-3-ethynyl-6-[(2R,5S)-5-ethynyl-2,3,4,5-tetrahydropyridin-2-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | (3R,6S)-3-ethynyl-6-[(2R,5S)-5-ethynyl-2,3,4,5-tetrahydropyridin-2-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 90321779 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (3R,6S)-3-ethynyl-6-[(2R,5S)-5-ethynyl-2,3,4,5-tetrahydropyridin-2-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | C#C[C@H]1C=N[C@@H]([C@@H]2C=C[C@H](C#C)CN2)CC1 |
| InChI | InChI=1S/C14H16N2/c1-3-11-5-7-13(15-9-11)14-8-6-12(4-2)10-16-14/h1-2,5,7,10-15H,6,8-9H2/t11-,12+,13-,14+/m0/s1 |
| InChIKey | FNWHOGOUZZKTGS-RFQIPJPRSA-N |
| XLogP | 1.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|