C8H15NO — CID 90322116
3-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-c]pyridine (PubChem CID 90322116) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 3-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-c]pyridine.
| Compound Name | 3-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 90322116 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 3-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-c]pyridine |
| SMILES | CC1COC2CNCCC12 |
| InChI | InChI=1S/C8H15NO/c1-6-5-10-8-4-9-3-2-7(6)8/h6-9H,2-5H2,1H3 |
| InChIKey | XXZIZOHAVVRPIN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |