C22H19N3O2S — CID 90322195
4-methyl-2-nitro-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]benzonitrile (PubChem CID 90322195) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-methyl-2-nitro-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]benzonitrile.
| Compound Name | 4-methyl-2-nitro-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 90322195 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-methyl-2-nitro-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]benzonitrile |
| SMILES | Cc1cc([N+](=O)[O-])c(C#N)cc1Cc1nc(-c2ccc3c(c2)CCCC3)cs1 |
| InChI | InChI=1S/C22H19N3O2S/c1-14-8-21(25(26)27)19(12-23)10-18(14)11-22-24-20(13-28-22)17-7-6-15-4-2-3-5-16(15)9-17/h6-10,13H,2-5,11H2,1H3 |
| InChIKey | QVMPBRJESVCASL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|