C38H46N4O3S — CID 90322569
(7aR)-5-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]-N-[(1S)-1-naphthalen-1-ylethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide (PubChem CID 90322569) has the molecular formula C38H46N4O3S and a molecular weight of 638.88 g/mol. Its IUPAC name is (7aR)-5-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]-N-[(1S)-1-naphthalen-1-ylethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide.
| Compound Name | (7aR)-5-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]-N-[(1S)-1-naphthalen-1-ylethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90322569 |
| Molecular Formula | C38H46N4O3S |
| Molecular Weight | 638.88 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | (7aR)-5-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]-N-[(1S)-1-naphthalen-1-ylethyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-2-carboxamide |
| SMILES | C[C@H](NC(=O)N1CC2CN(CC[C@](C)(CN(C)S(=O)(=O)c3ccccc3)c3ccccc3)CC[C@H]2C1)c1cccc2ccccc12 |
| InChI | InChI=1S/C38H46N4O3S/c1-29(35-20-12-14-30-13-10-11-19-36(30)35)39-37(43)42-26-31-21-23-41(25-32(31)27-42)24-22-38(2,33-15-6-4-7-16-33)28-40(3)46(44,45)34-17-8-5-9-18-34/h4-20,29,31-32H,21-28H2,1-3H3,(H,39,43)/t29-,31-,32?,38+/m0/s1 |
| InChIKey | KYGYDAKDXXKLMA-QQXITUETSA-N |
| XLogP | 6.53 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.88 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |